ChemNet > CAS > 1455-18-1 3-Methylbenzo[b]thiophene
1455-18-1 3-Methylbenzo[b]thiophene
| Nama produk |
3-Methylbenzo[b]thiophene |
| Nama Inggeris |
3-Methylbenzo[b]thiophene; Methylbenzobthiophene; 3-Methylthianaphthene; 3-methyl-1-benzothiophene |
| MF |
C9H8S |
| Berat Molekul |
148.2248 |
| InChI |
InChI=1/C9H8S/c1-7-6-10-9-5-3-2-4-8(7)9/h2-6H,1H3 |
| CAS NO |
1455-18-1 |
| EINECS |
215-934-6 |
| Struktur Molekul |
![1455-18-1 3-Methylbenzo[b]thiophene](https://images-a.chemnet.com/suppliers/chembase/485/136485.gif)
|
| Kepadatan |
1.146g/cm3 |
| Titik didih |
243°C at 760 mmHg |
| Indeks bias |
1.652 |
| Titik nyala |
72.4°C |
| Tekanan wap |
0.0514mmHg at 25°C |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
